SSR128129E is an orally-active and allosteric FGFR1 inhibitor with IC50 of 1.9 M, while not affecting other related RTKs.
For research use only. We do not sell to patients.
| Name | SSR128129E |
|---|---|
| Iupac Chemical Name | Sodium 2-amino-5-(1-methoxy-2-methylindolizine-3-carbonyl)benzoate |
| Synonyms | SSR128129E ; SSR128129E ; SSR 128129E |
| Molecular Formula | C18H15N2O4.Na |
| Molecular Weight | 346.31 |
| Smile | CC1=C(N2C=CC=CC2=C1OC)C(=O)C3=CC(=C(C=C3)N)C(=O)[O-].[Na+] |
| InChiKey | JFBMSTWZURKQOC-UHFFFAOYSA-M |
| InChi | InChI=1S/C18H16N2O4.Na/c1-10-15(20-8-4-3-5-14(20)17(10)24-2)16(21)11-6-7-13(19)12(9-11)18(22)23;/h3-9H,19H2,1-2H3,(H,22,23);/q;+1/p-1 |
| CAS Number | 848318-25-2 |
| Related CAS |
| Packaging | Price | Availability | Purity | Shipping Time |
|---|---|---|---|---|
| Bulk | Enquiry | Enquiry | Enquiry |
| Formulation | yellow solid |
|---|---|
| Purity | 98% |
| Storage | 3 years -20ºCpowder |
| Solubility | 5mg/ml in DMSO |
| Handling | |
| Shipping Condition | Shipped under ambient temperature |
| HS Code |
| Targets | |
|---|---|
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study |