| Name | WH-4-023 |
| Iupac Chemical Name | Carbamic acid, N-(2,4-dimethoxyphenyl)-N-[2-[[4-(4-methyl-1-piperazinyl)phenyl]amino]-4-pyrimidinyl]-, 2,6-dimethylphenyl ester |
| Synonyms | N/A |
| Molecular Formula | C32H36N6O4 |
| Molecular Weight | 568.67 |
| Smile | O=C(OC1=C(C)C=CC=C1C)N(C2=CC=C(OC)C=C2OC)C3=NC(NC4=CC=C(N5CCN(C)CC5)C=C4)=NC=C3 |
| InChiKey | NBTNHSGBRGTFJS-UHFFFAOYSA-N |
| InChi | InChI=1S/C32H36N6O4/c1-22-7-6-8-23(2)30(22)42-32(39)38(27-14-13-26(40-4)21-28(27)41-5)29-15-16-33-31(35-29)34-24-9-11-25(12-10-24)37-19-17-36(3)18-20-37/h6-16,21H,17-20H2,1-5H3,(H,33,34,35) |
| CAS Number | 837422-57-8 |
| Related CAS | |