Venetoclax, formerly known as ABT-199(GDC-0199), is a Bcl-2-selective inhibitor with Ki
For research use only. We do not sell to patients.
| Name | Venetoclax(ABT-199) |
|---|---|
| Iupac Chemical Name | 2-((1H-pyrrolo[2,3-b]pyridin-5-yl)oxy)-4-(4-((4'-chloro-5,5-dimethyl-3,4,5,6-tetrahydro-[1,1'-biphenyl]-2-yl)methyl)piperazin-1-yl)-N-((3-nitro-4-(((tetrahydro-2H-pyran-4-yl)methyl)amino)phenyl)sulfonyl)benzamide |
| Synonyms | Venetoclax;ABT-199;GDC-0199 |
| Molecular Formula | C45H50ClN7O7S |
| Molecular Weight | 868.44 |
| Smile | N1C=CC=2C1=NC=C(C2)OC2=C(C(=O)NS(=O)(=O)C1=CC(=C(C=C1)NCC1CCOCC1)[N+](=O)[O-])C=CC(=C2)N2CCN(CC2)CC2=C(CC(CC2)(C)C)C2=CC=C(C=C2)Cl |
| InChiKey | LQBVNQSMGBZMKD-UHFFFAOYSA-N |
| InChi | InChI=1S/C45H50ClN7O7S/c1-45(2)15-11-33(39(26-45)31-3-5-34(46)6-4-31)29-51-17-19-52(20-18-51)35-7-9-38(42(24-35)60-36-23-32-12-16-47-43(32)49-28-36)44(54)50-61(57,58)37-8-10-40(41(25-37)53(55)56)48-27-30-13-21-59-22-14-30/h3-10,12,16,23-25,28,30,48H,11,13-15,17-22,26-27,29H2,1-2H3,(H,47,49)(H,50,54) |
| CAS Number | 1257044-40-8 |
| Related CAS |
| Packaging | Price | Availability | Purity | Shipping Time |
|---|---|---|---|---|
| Bulk | Enquiry | Enquiry | Enquiry |
| Formulation | crystalline solid |
|---|---|
| Purity | 98% |
| Storage | 3 years -20℃powder |
| Solubility | DMSO 100 mg/ml; water <1 mg/ml |
| Handling | |
| Shipping Condition | Shipped under ambient temperature as non-hazardous chemical. |
| HS Code |
| Targets | |
|---|---|
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study |