Vaborbactam, also known as RPX7009, is a potent and selective beta-lactamase inhibitor.
For research use only. We do not sell to patients.
| Name | Vaborbactam |
|---|---|
| Iupac Chemical Name | 2-((3R,6S)-2-hydroxy-3-(2-(thiophen-2-yl)acetamido)-1,2-oxaborinan-6-yl)acetic acid |
| Synonyms | RPX-7009; RPX7009; RPX 7009; MP-7009; MP7009; MP 7009; REBO-07; MP-7; Vaborbactam |
| Molecular Formula | C12H16BNO5S |
| Molecular Weight | 297.13 |
| Smile | O=C(O)C[C@@H]1CC[C@H](NC(CC2=CC=CS2)=O)B(O)O1 |
| InChiKey | IOOWNWLVCOUUEX-WPRPVWTQSA-N |
| InChi | InChI=1S/C12H16BNO5S/c15-11(7-9-2-1-5-20-9)14-10-4-3-8(6-12(16)17)19-13(10)18/h1-2,5,8,10,18H,3-4,6-7H2,(H,14,15)(H,16,17)/t8-,10-/m0/s1 |
| CAS Number | 1360457-46-0 |
| Related CAS |
| Packaging | Price | Availability | Purity | Shipping Time |
|---|---|---|---|---|
| Bulk | Enquiry | Enquiry | Enquiry |
| Formulation | Off-white solid to white solid |
|---|---|
| Purity | >98% |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| Solubility | Soluble in DMSO |
| Handling | |
| Shipping Condition | Shipped under ambient temperature |
| HS Code |
| Targets | |
|---|---|
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study |