Tasimelteon (trade name Hetlioz) is a selective agonist for the melatonin receptors MT1 and MT2 in the suprachiasmatic nucleus of the brain. it was approved by the FDA for the treatment of non-24-hour sleepCwake disorder(often designated as N24HSWD).
For research use only. We do not sell to patients.
| Name | Tasimelteon |
|---|---|
| Iupac Chemical Name | (1R-trans)-N-[[2-(2,3-Dihydro-4-benzofuranyl)cyclopropyl]methyl]propanamide |
| Synonyms | BMS214778;MA 1;VEC 162;TasiMelteon;BMS214778 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 |
| Smile | O1CCC2=C1C=CC=C2[C@H]2[C@@H](C2)CNC(CC)=O |
| InChiKey | PTOIAAWZLUQTIO-GXFFZTMASA-N |
| InChi | InChI=1S/C15H19NO2/c1-2-15(17)16-9-10-8-13(10)11-4-3-5-14-12(11)6-7-18-14/h3-5,10,13H,2,6-9H2,1H3,(H,16,17)/t10-,13+/m0/s1 |
| CAS Number | 609799-22-6 |
| Related CAS |
| Packaging | Price | Availability | Purity | Shipping Time |
|---|---|---|---|---|
| Bulk | Enquiry | Enquiry | Enquiry |
| Purity | 98% |
|---|---|
| Storage | 3 years -20ºCpowder |
| Solubility | 2mg/ml in DMSO |
| Handling | |
| Shipping Condition | Shipped under ambient temperature. |
| HS Code |
| Targets | |
|---|---|
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study |