SAG is a potent Smoothened (Smo) receptor agonist (Kd = 59 nM); antagonizes Cyclopamine action at the Smo receptor. SAG potently activates the Hedgehog signaling pathway in Shh-light 2 cells (EC50 ~ 3 nM). Induces pathway activation independently of Ptch proteins.
For research use only. We do not sell to patients.
| Name | SAG |
|---|---|
| Iupac Chemical Name | 3-chloro-N-((1r,4r)-4-(methylamino)cyclohexyl)-N-(3-(pyridin-4-yl)benzyl)benzo[b]thiophene-2-carboxamide |
| Synonyms | SAG |
| Molecular Formula | C28H28ClN3OS |
| Molecular Weight | 490.06 |
| Smile | O=C(C1=C(Cl)C2=CC=CC=C2S1)N([C@H]3CC[C@H](NC)CC3)CC4=CC=CC(C5=CC=NC=C5)=C4 |
| InChiKey | VFSUUTYAEQOIMW-YHBQERECSA-N |
| InChi | InChI=1S/C28H28ClN3OS/c1-30-22-9-11-23(12-10-22)32(28(33)27-26(29)24-7-2-3-8-25(24)34-27)18-19-5-4-6-21(17-19)20-13-15-31-16-14-20/h2-8,13-17,22-23,30H,9-12,18H2,1H3/t22-,23- |
| CAS Number | 912545-86-9 |
| Related CAS | 2095432-58-7 (HCl) 912545-86-9 (free base) |
| Packaging | Price | Availability | Purity | Shipping Time |
|---|---|---|---|---|
| Bulk | Enquiry | Enquiry | Enquiry |
| Formulation | light yellow solid |
|---|---|
| Purity | 99.03% |
| Storage | 3 years -20ºCpowder 6 months-80ºCin solvent |
| Solubility | Soluble in DMSO to 20 mM |
| Handling | |
| Shipping Condition | Shipped under ambient temperature |
| HS Code |
| Targets | |
|---|---|
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study |