Ribociclib (LEE011) is an orally available, and highly specific CDK4/6 inhibitor. Phase 3
For research use only. We do not sell to patients.
| Name | Ribociclib (LEE011) |
|---|---|
| Iupac Chemical Name | 7-cyclopentyl-N,N-dimethyl-2-((5-(piperazin-1-yl)pyridin-2-yl)amino)-7H-pyrrolo[2,3-d]pyrimidine-6-carboxamide |
| Synonyms | Ribociclib;LEE011 |
| Molecular Formula | C23H30N8O |
| Molecular Weight | 434.54 |
| Smile | C1(CCCC1)N1C(=CC2=C1N=C(N=C2)NC2=NC=C(C=C2)N2CCNCC2)C(=O)N(C)C |
| InChiKey | RHXHGRAEPCAFML-UHFFFAOYSA-N |
| InChi | InChI=1S/C23H30N8O/c1-29(2)22(32)19-13-16-14-26-23(28-21(16)31(19)17-5-3-4-6-17)27-20-8-7-18(15-25-20)30-11-9-24-10-12-30/h7-8,13-15,17,24H,3-6,9-12H2,1-2H3,(H,25,26,27,28) |
| CAS Number | 1211441-98-3 |
| Related CAS |
| Packaging | Price | Availability | Purity | Shipping Time |
|---|---|---|---|---|
| Bulk | Enquiry | Enquiry | Enquiry |
| Formulation | yellow solid |
|---|---|
| Purity | 98% |
| Storage | 3 years -20ºCpowder 6 months-80ºCin solvent |
| Solubility | 5mg/ml in DMSO |
| Handling | |
| Shipping Condition | Shipped under ambient temperature |
| HS Code |
| Targets | |
|---|---|
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study |