RG7800(RO6885247) is a small molecule modifier of survival motor neuron 2 splicing.
For research use only. We do not sell to patients.
| Name | RG7800 ( RO6885247 ) |
|---|---|
| Iupac Chemical Name | 2-(4-ethyl-6-methylpyrazolo[1,5-a]pyrazin-2-yl)-9-methyl-7-(1-methylpiperidin-4-yl)-4H-pyrido[1,2-a]pyrimidin-4-one |
| Synonyms | RG7800 ; RO6885247 ; RG-7800 ; RG 7800 ; RO-6885247 ; RO 6885247 |
| Molecular Formula | C24H28N6O |
| Molecular Weight | 416.5 |
| Smile | O=C1C=C(C2=NN3C(C(CC)=NC(C)=C3)=C2)N=C4N1C=C(C5CCN(C)CC5)C=C4C |
| InChiKey | GYFRQCMDLBNZSF-UHFFFAOYSA-N |
| InChi | InChI=1S/C24H28N6O/c1-5-19-22-11-21(27-30(22)13-16(3)25-19)20-12-23(31)29-14-18(10-15(2)24(29)26-20)17-6-8-28(4)9-7-17/h10-14,17H,5-9H2,1-4H3 |
| CAS Number | 1449598-06-4 |
| Related CAS | 1449598-06-4 |
| Packaging | Price | Availability | Purity | Shipping Time |
|---|---|---|---|---|
| Bulk | Enquiry | Enquiry | Enquiry |
| Formulation | crystalline solid |
|---|---|
| Purity | ≧98.0% |
| Storage | 3 years -20ºCpowder;6 months-80ºCin solvent |
| Solubility | Soluble in DMSO, not in water |
| Handling | |
| Shipping Condition | Shipped under ambient temperature as non-hazardous chemical. |
| HS Code |
| Targets | |
|---|---|
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study |