PF-9366 is a novel inhibitor of human methionine adenosyltransferase 2A (Mat2A), the extrahepatic isoform.
For research use only. We do not sell to patients.
| Name | PF-9366 |
|---|---|
| Iupac Chemical Name | 2-(7-Chloro-5-phenyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)-N,N-dimethylethan-1-amine |
| Synonyms | PF-9366; PF 9366; PF9366. |
| Molecular Formula | C20H19ClN4 |
| Molecular Weight | 350.85 |
| Smile | CN(C)CCC1=NN=C2N1C3=C(C=C(Cl)C=C3)C(C4=CC=CC=C4)=C2 |
| InChiKey | LYLASWLQCMKZAT-UHFFFAOYSA-N |
| InChi | InChI=1S/C20H19ClN4/c1-24(2)11-10-19-22-23-20-13-16(14-6-4-3-5-7-14)17-12-15(21)8-9-18(17)25(19)20/h3-9,12-13H,10-11H2,1-2H3 |
| CAS Number | 72882-78-1 |
| Related CAS | 72882-78-1 |
| Packaging | Price | Availability | Purity | Shipping Time |
|---|---|---|---|---|
| Bulk | Enquiry | Enquiry | Enquiry |
| Formulation | off-white solid |
|---|---|
| Purity | ≧98.0% |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| Solubility | Soluble in DMSO, not in water |
| Handling | |
| Shipping Condition | Shipped under ambient temperature |
| HS Code |
| Targets | |
|---|---|
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study |