Org-26576 is an AMPA glutamate receptor modulator potentially for the treatment of depression and attention deficit disorder. In animal studies it has been shown to effectively potentiate AMPA receptor function, leading to increased BDNF release and enhanced neuronal differentiation and survival, as well as producing nootropic effects in standardised assays.
For research use only. We do not sell to patients.
| Name | Org-26576 |
|---|---|
| Iupac Chemical Name | (3S)-3,4-Propano-2,3-dihydropyrido[3,2-f][1,4]oxazepine-5(4H)-one |
| Synonyms | Org-26576; Org26576; Org 26576 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 |
| Smile | O=C1N(CCC2)[C@]2([H])COC3=NC=CC=C13 |
| InChiKey | FIKUEZUFASUKAH-QMMMGPOBSA-N |
| InChi | InChI=1S/C11H12N2O2/c14-11-9-4-1-5-12-10(9)15-7-8-3-2-6-13(8)11/h1,4-5,8H,2-3,6-7H2/t8-/m0/s1 |
| CAS Number | 1026791-61-6;100044-96-0 |
| Related CAS |
| Packaging | Price | Availability | Purity | Shipping Time |
|---|---|---|---|---|
| Bulk | Enquiry | Enquiry | Enquiry |
| Formulation | off-white solid |
|---|---|
| Purity | 98% |
| Storage | 3 years -20ºCpowder |
| Solubility | Soluble in DMSO |
| Handling | |
| Shipping Condition | Shipped under ambient temperature as non-hazardous chemical. |
| HS Code |
| Targets | |
|---|---|
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study |