NSC 42834(JAK2 Inhibitor V, Z3), a novel specific inhibitor of Jak2, inhibits Jak2-V617F and Jak2-WT autophosphorylation in a dose-dependent manner but was not cytotoxic to cells at concentrations that inhibited kinase activity.
For research use only. We do not sell to patients.
| Name | NSC 42834 |
|---|---|
| Iupac Chemical Name | 2-methyl-1-phenyl-4-(pyridin-2-yl)-2-(2-(pyridin-2-yl)ethyl)butan-1-one |
| Molecular Formula | C23H24N2O |
| Molecular Weight | 344.45 |
| Smile | CC(C(=O)C1=CC=CC=C1)(CCC1=NC=CC=C1)CCC1=NC=CC=C1 |
| InChiKey | SETYDCSRABYHSW-UHFFFAOYSA-N |
| InChi | InChI=1S/C23H24N2O/c1-23(15-13-20-11-5-7-17-24-20,16-14-21-12-6-8-18-25-21)22(26)19-9-3-2-4-10-19/h2-12,17-18H,13-16H2,1H3 |
| CAS Number | 195371-52-9 |
| Related CAS |
| Packaging | Price | Availability | Purity | Shipping Time |
|---|---|---|---|---|
| Bulk | Enquiry | Enquiry | Enquiry |
| Formulation | light yellow oil |
|---|---|
| Purity | 98% |
| Handling | |
| HS Code |
| Targets | |
|---|---|
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study |