Mephenytoin(CAS 50-12-4) is a hydantoin, used as an anticonvulsant.Mephenytoin(CAS 50-12-4)is a hydantoin-derivative anticonvulsant used to control various partial seizures. It is generally reserved for treatment of individuals refractory to less toxic agents.
For research use only. We do not sell to patients.
| Name | Mephenytoin |
|---|---|
| Iupac Chemical Name | 5-ethyl-3-methyl-5-phenylimidazolidine-2,4-dione |
| Synonyms | Mephenytoin;Mesantoin |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.25 |
| Smile | O=C1N(C)C(C(C2=CC=CC=C2)(CC)N1)=O |
| InChiKey | GMHKMTDVRCWUDX-UHFFFAOYSA-N |
| InChi | InChI=1S/C12H14N2O2/c1-3-12(9-7-5-4-6-8-9)10(15)14(2)11(16)13-12/h4-8H,3H2,1-2H3,(H,13,16) |
| CAS Number | 50-12-4 |
| Related CAS |
| Packaging | Price | Availability | Purity | Shipping Time |
|---|---|---|---|---|
| Bulk | Enquiry | Enquiry | Enquiry |
| Formulation | off-white solid to white solid |
|---|---|
| Purity | 98% |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years) |
| Solubility | Soluble in DMSO, not in water |
| Handling | |
| Shipping Condition | Shipped under ambient temperature as non-hazardous chemical. |
| HS Code |
| Targets | |
|---|---|
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study |