6-BIO(6-Bromoindirubin-3'-oxime) is a potent and selective inhibitor of GSK-3 and CDK1CcyclinB complex with IC50 of 5 nM /320 nM/83 nM for GSK-3/CDK1/CDK5 respectively.
For research use only. We do not sell to patients.
| Name | MLS-2052 |
|---|---|
| Iupac Chemical Name | 6-Bromoindirubin-3'-oxime |
| Synonyms | BIO; GSK3 Inhibitor IX; MLS 2052; MLS-2052; MLS2052. |
| Molecular Formula | C16H10BrN3O2 |
| Molecular Weight | 356.17 |
| Smile | c1ccc2c(c1)/C(=N\O)/C(=C/3\c4ccc(cc4NC3=O)Br)/N2 |
| InChiKey | DDLZLOKCJHBUHD-WAVHTBQISA-N |
| InChi | InChI=1S/C16H10BrN3O2/c17-8-5-6-9-12(7-8)19-16(21)13(9)15-14(20-22)10-3-1-2-4-11(10)18-15/h1-7,18,22H,(H,19,21)/b15-13-,20-14+ |
| CAS Number | 667463-62-9 |
| MDL | MFCD08705318 |
| Related CAS |
| Packaging | Price | Availability | Purity | Shipping Time |
|---|---|---|---|---|
| Bulk | Enquiry | Enquiry | Enquiry |
| Purity | 98% |
|---|---|
| Handling | |
| HS Code |
| Targets | |
|---|---|
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study |