MDK3627, also known as Mutant EGFR inhibitor, is a selective and potent Mutated EGFR inhibitor.
For research use only. We do not sell to patients.
| Name | MDK3627 |
|---|---|
| Iupac Chemical Name | (Z)-N-(5-((5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl)amino)-2-((2-(dimethylamino)ethyl)(methyl)amino)-4-methoxyphenyl)acrylimidic acid |
| Synonyms | MDK3627; MDK 3627; MDK-3627; Mutant EGFR inhibitor; |
| Molecular Formula | C27H30ClN7O2 |
| Molecular Weight | 520.034 |
| Smile | C=C/C(O)=N/C1=CC(NC2=NC=C(Cl)C(C3=CNC4=C3C=CC=C4)=N2)=C(OC)C=C1N(CCN(C)C)C |
| InChiKey | SUPQPCQJBYPRPC-UHFFFAOYSA-N |
| InChi | InChI=1S/C27H30ClN7O2/c1-6-25(36)31-21-13-22(24(37-5)14-23(21)35(4)12-11-34(2)3)32-27-30-16-19(28)26(33-27)18-15-29-20-10-8-7-9-17(18)20/h6-10,13-16,29H,1,11-12H2,2-5H3,(H,31,36)(H,30,32,33) |
| CAS Number | 1421373-62-7 |
| Related CAS |
| Packaging | Price | Availability | Purity | Shipping Time |
|---|---|---|---|---|
| Bulk | Enquiry | Enquiry | Enquiry |
| Formulation | Off-white solid to white solid |
|---|---|
| Purity | >98% |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| Solubility | Soluble in DMSO |
| Handling | |
| Shipping Condition | Shipped under ambient temperature |
| HS Code |
| Targets | |
|---|---|
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study |