For research use only. We do not sell to patients.
| Name | Kinesore |
|---|---|
| Iupac Chemical Name | (E)-3,5-Dibromo-N'-((2,5-dimethyl-1-(3-nitrophenyl)-1H-pyrrol-3-yl)methylene)-4-hydroxybenzohydrazide |
| Synonyms | Kinesore; |
| Molecular Formula | C20H16Br2N4O4 |
| Molecular Weight | 536.18 |
| Smile | O=C(N/N=C/C1=C(C)N(C2=CC=CC([N+]([O-])=O)=C2)C(C)=C1)C3=CC(Br)=C(O)C(Br)=C3 |
| InChiKey | DUGCMEGLYHBMAR-AUEPDCJTSA-N |
| InChi | InChI=1S/C20H16Br2N4O4/c1-11-6-14(12(2)25(11)15-4-3-5-16(9-15)26(29)30)10-23-24-20(28)13-7-17(21)19(27)18(22)8-13/h3-10,27H,1-2H3,(H,24,28)/b23-10+ |
| CAS Number | 363571-83-9 |
| Related CAS |
| Packaging | Price | Availability | Purity | Shipping Time |
|---|---|---|---|---|
| Bulk | Enquiry | Enquiry | Enquiry |
| Formulation | Off-white solid to white solid |
|---|---|
| Purity | >98% |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| Solubility | Soluble in DMSO |
| Handling | |
| Shipping Condition | Shipped under ambient temperature |
| HS Code |
| Targets | |
|---|---|
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study |