For research use only. We do not sell to patients.
| Name | KC01 |
|---|---|
| Iupac Chemical Name | (Z)-6-(2-oxo-4-tridecyloxetan-3-ylidene)hexanamide |
| Synonyms | KC01; K C01; K-C01 |
| Molecular Formula | C22H39NO3 |
| Molecular Weight | 365.56 |
| Smile | O=C(N)CCCC/C=C1C(OC\1CCCCCCCCCCCCC)=O |
| InChiKey | RJBBAPPWVJEOMC-MNDPQUGUSA-N |
| InChi | InChI=1S/C22H39NO3/c1-2-3-4-5-6-7-8-9-10-11-14-17-20-19(22(25)26-20)16-13-12-15-18-21(23)24/h16,20H,2-15,17-18H2,1H3,(H2,23,24)/b19-16- |
| CAS Number | 1646795-59-6 |
| Related CAS |
| Packaging | Price | Availability | Purity | Shipping Time |
|---|---|---|---|---|
| Bulk | Enquiry | Enquiry | Enquiry |
| Formulation | Off-white solid to white solid |
|---|---|
| Purity | >98% |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| Solubility | Soluble in DMSO |
| Handling | |
| Shipping Condition | Shipped under ambient temperature |
| HS Code |
| Targets | |
|---|---|
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study |