| Name | JPH203 HCl ( Nanvuranlat ) |
| Iupac Chemical Name | (S)-2-amino-3-(4-((5-amino-2-phenylbenzo[d]oxazol-7-yl)methoxy)-3,5-dichlorophenyl)propanoic acid dihydrochloride |
| Synonyms | JPH203 dihydrochloride ; JPH203 HCl; JPH203 ; JPH-203 ; JPH 203 ; KYT-0353 ; KYT 0353 ; KYT0353 ; Nanvuranlat |
| Molecular Formula | C23H21Cl4N3O4 |
| Molecular Weight | 545.238 |
| Smile | O=C(O)[C@@H](N)CC1=CC(Cl)=C(OCC2=C(OC(C3=CC=CC=C3)=N4)C4=CC(N)=C2)C(Cl)=C1.[H]Cl.[H]Cl |
| InChiKey | MJSAOPNUSNNYQL-NTEVMMBTSA-N |
| InChi | InChI=1S/C23H19Cl2N3O4.2ClH/c24-16-6-12(8-18(27)23(29)30)7-17(25)21(16)31-11-14-9-15(26)10-19-20(14)32-22(28-19)13-4-2-1-3-5-13;;/h1-7,9-10,18H,8,11,26-27H2,(H,29,30);2*1H/t18-;;/m0../s1 |
| CAS Number | 1597402-27-1 |
| Related CAS | 1597402-27-1 |