JNJ-42041935 is a potent (pKi = 7.3-7.9), 2-oxoglutarate competitive, reversible, and selective inhibitor of PHD enzymes.
For research use only. We do not sell to patients.
Chemical Information
| Name | JNJ-42041935 |
| Iupac Chemical Name | 1-[6-chloro-5-(trifluoromethoxy)-1H-benzimidazol-2-yl]pyrazole-4-carboxylic acid |
| Synonyms | JNJ 42041935; JNJ42041935 |
| Molecular Formula | C12H6ClF3N4O3 |
| Molecular Weight | 346.65 |
| Smile | C1=C2C(=CC(=C1Cl)OC(F)(F)F)N=C(N2)N3C=C(C=N3)C(=O)O |
| InChiKey | FXHHASJVTYRJHH-UHFFFAOYSA-N |
| InChi | InChI=1S/C12H6ClF3N4O3/c13-6-1-7-8(2-9(6)23-12(14,15)16)19-11(18-7)20-4-5(3-17-20)10(21)22/h1-4H,(H,18,19)(H,21,22) |
| CAS Number | 1193383-09-3 |
| Related CAS | |
Ordering Information
| Packaging | Price | Availability | Purity | Shipping Time |
| Bulk | | Enquiry | Enquiry | Enquiry |
| Formulation | Solid powder |
| Purity | 98% |
| Storage | -20 ºC for 3 years |
| Solubility | Soluble in DMSO |
| Handling | |
| Shipping Condition | Shipped under ambient temperature |
| HS Code | |
| Targets | |
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study | |