IU1 is a reversible and specific inhibitor of proteasome-associating Usp14. It does not inhibit other deubiquitinating enzymes of the 26S proteasome. It partially inhibits the ubiquitin chain trimming activity of the 26S proteasome, which could function to stimulate the degradation of some proteasomal substrates.
For research use only. We do not sell to patients.
| Name | IU1 |
|---|---|
| Iupac Chemical Name | 1-[1-(4-Fluorophenyl)-2,5-dimethyl-1H-pyrrol-3-yl]-2-(1-pyrrolidinyl)ethanone |
| Synonyms | IU1 |
| Molecular Formula | C18H21FN2O |
| Molecular Weight | 300.37 |
| Smile | CC1=CC(C(CN2CCCC2)=O)=C(C)N1C3=CC=C(F)C=C3 |
| InChiKey | JUWDSDKJBMFLHE-UHFFFAOYSA-N |
| InChi | InChI=1S/C18H21FN2O/c1-13-11-17(18(22)12-20-9-3-4-10-20)14(2)21(13)16-7-5-15(19)6-8-16/h5-8,11H,3-4,9-10,12H2,1-2H3 |
| CAS Number | 314245-33-5 |
| Related CAS |
| Packaging | Price | Availability | Purity | Shipping Time |
|---|---|---|---|---|
| Bulk | Enquiry | Enquiry | Enquiry |
| Formulation | light yellow solid |
|---|---|
| Purity | 98% |
| Storage | 3 years -20ºCpowder |
| Solubility | 5mg/ml in DMSO |
| Handling | |
| Shipping Condition | Shipped under ambient temperature. |
| HS Code |
| Targets | |
|---|---|
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study |