Hexaminolevulinate hydrochloride, also known as hexyl 5-aminolevulinate HCl, is the hexyl ester of 5-aminolevulinic acid (ALA) with photodynamic properties. As a precursor of photoactive porphorins, hexyl 5-aminolevulinate induces the endogenous production of the photosensitizer protoporphyrin IX (PPIX) which accumulates selectively in tumor tissue. When exposed to specific wavelengths of light, PPIX is activated and, depending on the wavelength and/or intensity of light, either fluoresces, thereby allowing tumor imaging, or induces tumor cell apoptosis. Check for active clinical trials or closed clinical trials using this agent. (NCI Thesaurus).
For research use only. We do not sell to patients.
| Name | Hexaminolevulinate HCl |
|---|---|
| Iupac Chemical Name | Hexaminolevulinate HCl |
| Synonyms | P-1206. Abbreviation: HAL. hexaminolevulinate; 5-Aminolevulinic acid hexyl ester; 5-ALA hexylester; US brand names: Hexvix; Cysview |
| Molecular Formula | C11H22ClNO3 |
| Molecular Weight | 251.75 |
| Smile | CCCCCCOC(=O)CCC(=O)CN.Cl |
| InChiKey | LZYXPFZBAZTOCH-UHFFFAOYSA-N |
| InChi | InChI=1S/C11H21NO3.ClH/c1-2-3-4-5-8-15-11(14)7-6-10(13)9-12;/h2-9,12H2,1H3;1H |
| CAS Number | 140898-91-5 |
| MDL | MFCD03695491 |
| Related CAS |
| Packaging | Price | Availability | Purity | Shipping Time |
|---|---|---|---|---|
| Bulk | Enquiry | Enquiry | Enquiry |
| Formulation | crystalline solid |
|---|---|
| Purity | 98% |
| Storage | 3 years -20ºCpowder |
| Solubility | Soluble in DMSO |
| Handling | |
| Shipping Condition | Shipped under ambient temperature as non-hazardous chemical. |
| HS Code |
| Targets | |
|---|---|
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study |