Gandotinib is an orally bioavailable imidazopyridazine and inhibitor of Janus kinase 2 mutant V617F (JAK2V617F)
For research use only. We do not sell to patients.
| Name | Gandotinib(LY2784544) |
|---|---|
| Iupac Chemical Name | 3-(4-chloro-2-fluorobenzyl)-2-methyl-N-(3-methyl-1H-pyrazol-5-yl)-8-(morpholinomethyl)imidazo[1,2-b]pyridazin-6-amine |
| Synonyms | LY2784544;LY 2784544;LY-2784544;Gandotinib. |
| Molecular Formula | C23H25ClFN7O |
| Molecular Weight | 469.94 |
| Smile | ClC1=CC(=C(CC2=C(N=C3N2N=C(C=C3CN3CCOCC3)NC3=CC(=NN3)C)C)C=C1)F |
| InChiKey | SQSZANZGUXWJEA-UHFFFAOYSA-N |
| InChi | InChI=1S/C23H25ClFN7O/c1-14-9-21(29-28-14)27-22-11-17(13-31-5-7-33-8-6-31)23-26-15(2)20(32(23)30-22)10-16-3-4-18(24)12-19(16)25/h3-4,9,11-12H,5-8,10,13H2,1-2H3,(H2,27,28,29,30) |
| CAS Number | 1229236-86-5 |
| Related CAS |
| Packaging | Price | Availability | Purity | Shipping Time |
|---|---|---|---|---|
| Bulk | Enquiry | Enquiry | Enquiry |
| Formulation | crystalline solid |
|---|---|
| Purity | 98% by HPLC |
| Storage | 3 years -20℃powder 6 months-80℃in solvent |
| Solubility | Soluble in DMSO to 20 mM |
| Handling | |
| Shipping Condition | Shipped under ambient temperature |
| HS Code |
| Targets | |
|---|---|
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study |