GSK-5959 is a potent and selective BRPF1 bromodomain inhibitor (IC50 = 80 nM).
For research use only. We do not sell to patients.
| Name | GSK-5959 |
|---|---|
| Iupac Chemical Name | N-[2,3-Dihydro-1,3-dimethyl-2-oxo-6-(1-piperidinyl)-1H-benzimidazol-5-yl]-2-methoxybenzamide |
| Synonyms | GSK-5959; GSK 5959; GSK5959. |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 |
| Smile | O=C(NC1=C(N2CCCCC2)C=C(N3C)C(N(C)C3=O)=C1)C4=CC=CC=C4OC |
| InChiKey | LTUGYAOMCKNTGG-UHFFFAOYSA-N |
| InChi | InChI=1S/C22H26N4O3/c1-24-18-13-16(23-21(27)15-9-5-6-10-20(15)29-3)17(26-11-7-4-8-12-26)14-19(18)25(2)22(24)28/h5-6,9-10,13-14H,4,7-8,11-12H2,1-3H3,(H,23,27) |
| CAS Number | 901245-65-6 |
| Related CAS |
| Packaging | Price | Availability | Purity | Shipping Time |
|---|---|---|---|---|
| Bulk | Enquiry | Enquiry | Enquiry |
| Formulation | Off-white solid to white solid |
|---|---|
| Purity | >98% |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| Solubility | Soluble in DMSO |
| Handling | |
| Shipping Condition | Shipped under ambient temperature |
| HS Code |
| Targets | |
|---|---|
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study |