GDC-0349 is a potent and selective ATP-competitive inhibitor of mTOR.
For research use only. We do not sell to patients.
| Name | GDC-0349 |
|---|---|
| Iupac Chemical Name | (S)-1-ethyl-3-(4-(4-(3-methylmorpholino)-7-(oxetan-3-yl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-2-yl)phenyl)urea |
| Synonyms | GDC0349,GDC 0349 |
| Molecular Formula | C24H32N6O3 |
| Molecular Weight | 452.55 |
| Smile | C(C)NC(=O)NC1=CC=C(C=C1)C=1N=C(C2=C(N1)CN(CC2)C2COC2)N2[C@H](COCC2)C |
| InChiKey | RGJOJUGRHPQXGF-INIZCTEOSA-N |
| InChi | InChI=1S/C24H32N6O3/c1-3-25-24(31)26-18-6-4-17(5-7-18)22-27-21-12-29(19-14-33-15-19)9-8-20(21)23(28-22)30-10-11-32-13-16(30)2/h4-7,16,19H,3,8-15H2,1-2H3,(H2,25,26,31)/t16-/m0/s1 |
| CAS Number | 1207360-89-1 |
| Related CAS |
| Packaging | Price | Availability | Purity | Shipping Time |
|---|---|---|---|---|
| Bulk | Enquiry | Enquiry | Enquiry |
| Formulation | crystalline solid |
|---|---|
| Purity | >98% by HPLC |
| Storage | 3 years -20ºCpowder |
| Solubility | Soluble in DMSO |
| Handling | |
| Shipping Condition | Shipped under ambient temperature as non-hazardous chemical. |
| HS Code |
| Targets | |
|---|---|
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study |