Elamipretide, also known as MTP-131 or D-Arg-Dmt-Lys-Phe-NH2,is a cardiolipin peroxidase inhibitor and mitochondria-targeted peptide.
For research use only. We do not sell to patients.
| Name | Elamipretide |
|---|---|
| Iupac Chemical Name | (S)-6-amino-N-((S)-1-amino-1-oxo-3-phenylpropan-2-yl)-2-((S)-2-((R)-2-amino-5-guanidinopentanamido)-3-(4-hydroxy-2,6-dimethylphenyl)propanamido)hexanamide |
| Synonyms | MTP-131;MTP 131;MTP131;Bendavia;RX-31 |
| Molecular Formula | C32H49N9O5 |
| Molecular Weight | 639.8 |
| Smile | NCCCC[C@@H](C(=O)N[C@H](C(=O)N)CC1=CC=CC=C1)NC([C@H](CC1=C(C=C(C=C1C)O)C)NC([C@@H](CCCNC(=N)N)N)=O)=O |
| InChiKey | SFVLTCAESLKEHH-WKAQUBQDSA-N |
| InChi | InChI=1S/C32H49N9O5/c1-19-15-22(42)16-20(2)23(19)18-27(41-29(44)24(34)11-8-14-38-32(36)37)31(46)39-25(12-6-7-13-33)30(45)40-26(28(35)43)17-21-9-4-3-5-10-21/h3-5,9-10,15-16,24-27,42H,6-8,11-14,17-18,33-34H2,1-2H3,(H2,35,43)(H,39,46)(H,40,45)(H,41,44)(H4,36,37,38)/t24-,25+,26+,27+/m1/s1 |
| CAS Number | 736992-21-5 |
| Related CAS |
| Packaging | Price | Availability | Purity | Shipping Time |
|---|---|---|---|---|
| Bulk | Enquiry | Enquiry | Enquiry |
| Formulation | off-white solid |
|---|---|
| Purity | 98% |
| Storage | -20 ºC for 3 years |
| Solubility | Soluble in DMSO |
| Handling | |
| Shipping Condition | Shipped under ambient temperature |
| HS Code |
| Targets | |
|---|---|
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study |