Elafibranor, also known as GFT-505, is a dual PPARα/δ agonist. Elafibranoris currently being studied for the treatment of cardiometabolic diseases including diabetes, insulin resistance, dyslipidemia, and non-alcoholic fatty liver disease (NAFLD).
For research use only. We do not sell to patients.
| Name | Elafibranor (GFT505) |
|---|---|
| Iupac Chemical Name | (E)-2-(2,6-dimethyl-4-(3-(4-(methylthio)phenyl)-3-oxoprop-1-en-1-yl)phenoxy)-2-methylpropanoic acid |
| Synonyms | Elafibranor ; GFT505 ; GFT-505 ; GFT 505 |
| Molecular Formula | C22H24O4S |
| Molecular Weight | 384.49 |
| Smile | CC(C)(OC1=C(C)C=C(/C=C/C(C2=CC=C(SC)C=C2)=O)C=C1C)C(O)=O |
| InChiKey | AFLFKFHDSCQHOL-IZZDOVSWSA-N |
| InChi | InChI=1S/C22H24O4S/c1-14-12-16(13-15(2)20(14)26-22(3,4)21(24)25)6-11-19(23)17-7-9-18(27-5)10-8-17/h6-13H,1-5H3,(H,24,25)/b11-6+ |
| CAS Number | 923978-27-2 |
| Related CAS |
| Packaging | Price | Availability | Purity | Shipping Time |
|---|---|---|---|---|
| Bulk | Enquiry | Enquiry | Enquiry |
| Formulation | light-yellow solid |
|---|---|
| Purity | ≧98.0% |
| Storage | 3 years -20ºCpowder;6 months-80ºCin solvent |
| Solubility | Soluble in DMSO |
| Handling | |
| Shipping Condition | Shipped under ambient temperature. |
| HS Code |
| Targets | |
|---|---|
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study |