DMH-1 is a potent and selective BMP inhibitor with IC50s of 27/107.9/<5 nM for ALK1/2/3 respectively; inactive on ALK5, BMPR2, AMPK and VEGFR2.
For research use only. We do not sell to patients.
Chemical Information
| Name | DMH-1 |
| Molecular Formula | C24H20N4O |
| Molecular Weight | 380.44 |
| Smile | CC(C)Oc1ccc(cc1)c2cnc3c(cnn3c2)c4ccnc5c4cccc5 |
| InChiKey | JMIFGARJSWXZSH-UHFFFAOYSA-N |
| InChi | InChI=1S/C24H20N4O/c1-16(2)29-19-9-7-17(8-10-19)18-13-26-24-22(14-27-28(24)15-18)20-11-12-25-23-6-4-3-5-21(20)23/h3-16H,1-2H3 |
| CAS Number | 1206711-16-1 |
| MDL | MFCD18384963 |
| Related CAS | |
Ordering Information
| Packaging | Price | Availability | Purity | Shipping Time |
| Bulk | | Enquiry | Enquiry | Enquiry |
| Purity | 98% |
| Solubility | DMSO |
| Handling | |
| HS Code | |
| Targets | |
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study | |