For research use only. We do not sell to patients.
| Name | Cefozopran |
|---|---|
| Iupac Chemical Name | Cefozopran |
| Synonyms | SCE-2787; SCE2787; SCE 2787 |
| Molecular Formula | C₁₉H₁₇N₉O₅S₂ |
| Molecular Weight | 515.53 |
| Smile | CO/N=C(/c1nc(sn1)N)\C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)Cn4cc[n+]5c4cccn5)C(=O)[O-].Cl |
| InChiKey | NTJHUKMPVIFDNY-XFDPNJHTSA-N |
| InChi | InChI=1S/C19H17N9O5S2.ClH/c1-33-24-11(14-23-19(20)35-25-14)15(29)22-12-16(30)28-13(18(31)32)9(8-34-17(12)28)7-26-5-6-27-10(26)3-2-4-21-27;/h2-6,12,17H,7-8H2,1H3,(H3-,20,22,23,25,29,31,32);1H/b24-11-;/t12-,17-;/m1./s1 |
| CAS Number | 113359-04-9 |
| MDL | MFCD00944908 |
| Related CAS |
| Packaging | Price | Availability | Purity | Shipping Time |
|---|---|---|---|---|
| Bulk | Enquiry | Enquiry | Enquiry |
| Formulation | off-white solid |
|---|---|
| Purity | 98% |
| Storage | 3 years -20ºCpowder |
| Solubility | Soluble in DMSO |
| Handling | |
| Shipping Condition | Shipped under ambient temperature as non-hazardous chemical. |
| HS Code |
| Targets | |
|---|---|
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study |