For research use only. We do not sell to patients.
| Name | Cefoselis |
|---|---|
| Iupac Chemical Name | Cefoselis |
| Synonyms | Cefoselis main-ring; 5-amino-2-{[(6R,7R)-7-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-2-carboxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl}-1-(2-hydroxyethyl)-1H-pyrazol-2-ium; |
| Molecular Formula | C₁₉H₂₂N₈O₆S₂ |
| Molecular Weight | 522.56 |
| Smile | CO/N=C(/c1csc(n1)N)\C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)C[n+]4ccc(n4CCO)N)C(=O)[O-] |
| InChiKey | BHXLLRXDAYEMPP-SBGRAJFYSA-N |
| InChi | InChI=1S/C19H22N8O6S2/c1-33-24-12(10-8-35-19(21)22-10)15(29)23-13-16(30)27-14(18(31)32)9(7-34-17(13)27)6-25-3-2-11(20)26(25)4-5-28/h2-3,8,13,17,20,28H,4-7H2,1H3,(H4,21,22,23,29,31,32)/b24-12-/t13-,17-/m1/s1 |
| CAS Number | 122841-10-5 |
| MDL | MFCD00864846 |
| Related CAS |
| Packaging | Price | Availability | Purity | Shipping Time |
|---|---|---|---|---|
| Bulk | Enquiry | Enquiry | Enquiry |
| Formulation | White to yellowish crystalline powder |
|---|---|
| Purity | 98% |
| Storage | 3 years -20ºCpowder |
| Solubility | Soluble in DMSO |
| Handling | |
| Shipping Condition | Shipped under ambient temperature as non-hazardous chemical. |
| HS Code |
| Targets | |
|---|---|
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study |