For research use only. We do not sell to patients.
| Name | CA-074 |
|---|---|
| Iupac Chemical Name | L-trans-Epoxysuccinyl-Ile-Pro-OH propylamide |
| Synonyms | L-trans-Epoxysuccinyl-Ile-Pro-OH propylamide |
| Molecular Formula | C18H29N3O6 |
| Molecular Weight | 383.44 |
| Smile | CCCNC(=O)[C@@H]1[C@H](O1)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N2CCC[C@H]2C(=O)O |
| InChiKey | ZEZGJKSEBRELAS-PEDHHIEDSA-N |
| InChi | InChI=1S/C18H29N3O6/c1-4-8-19-15(22)13-14(27-13)16(23)20-12(10(3)5-2)17(24)21-9-6-7-11(21)18(25)26/h10-14H,4-9H2,1-3H3,(H,19,22)(H,20,23)(H,25,26)/t10-,11-,12-,13-,14-/m0/s1 |
| CAS Number | 134448-10-5 |
| MDL | MFCD00797531 |
| Related CAS |
| Packaging | Price | Availability | Purity | Shipping Time |
|---|---|---|---|---|
| Bulk | Enquiry | Enquiry | Enquiry |
| Formulation | Solid powder |
|---|---|
| Purity | 98% by HPLC |
| Storage | -20 ºC for 3 years |
| Solubility | Soluble in DMSO |
| Handling | |
| Shipping Condition | Shipped under ambient temperature |
| HS Code |
| Targets | |
|---|---|
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study |