Belotecan Hydrochloride is the hydrochloride salt of the semi-synthetic camptothecin analogue belotecan with potential antitumor activity. Belotecan binds to and inhibits the activity of topoisomerase I, stabilizing the cleavable complex of topoisome
For research use only. We do not sell to patients.
| Name | Belotecan hydrochloride |
|---|---|
| Synonyms | Belotecan HCl; Camtobell hydrochloride; CKD 602 |
| Molecular Formula | C25H28ClN3O4 |
| Molecular Weight | 469.961 |
| Smile | CC[C@@]1(c2cc-3n(c(=O)c2COC1=O)Cc4c3nc5ccccc5c4CCNC(C)C)O.Cl |
| InChiKey | SJKBXKKZBKCHET-UQIIZPHYSA-N |
| InChi | InChI=1S/C25H27N3O4.ClH/c1-4-25(31)19-11-21-22-17(12-28(21)23(29)18(19)13-32-24(25)30)15(9-10-26-14(2)3)16-7-5-6-8-20(16)27-22;/h5-8,11,14,26,31H,4,9-10,12-13H2,1-3H3;1H/t25-;/m0./s1 |
| CAS Number | 213819-48-8 |
| MDL | MFCD07772313 |
| Related CAS |
| Packaging | Price | Availability | Purity | Shipping Time |
|---|---|---|---|---|
| Bulk | Enquiry | Enquiry | Enquiry |
| Formulation | Solid powder |
|---|---|
| Purity | 98% |
| Storage | -20 ℃ for 3 years |
| Solubility | Soluble in DMSO |
| Handling | |
| Shipping Condition | Shipped under ambient temperature |
| HS Code |
| Targets | |
|---|---|
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study |