BGT226 is a phosphatidylinositol 3-kinase (PI3K) inhibitor with potential antineoplastic activity.
For research use only. We do not sell to patients.
| Name | BGT-226 free base |
|---|---|
| Iupac Chemical Name | 8-(6-methoxypyridin-3-yl)-3-methyl-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]imidazo[4,5-c]quinolin-2-one |
| Synonyms | BGT 226; BGT-226; NVPBGT226 |
| Molecular Formula | C28H25F3N6O2 |
| Molecular Weight | 534.532 |
| Smile | CN1C2=CN=C3C=CC(=CC3=C2N(C1=O)C4=CC(=C(C=C4)N5CCNCC5)C(F)(F)F)C6=CN=C(C=C6)OC |
| InChiKey | BMMXYEBLEBULND-UHFFFAOYSA-N |
| InChi | InChI=1S/C28H25F3N6O2/c1-35-24-16-33-22-6-3-17(18-4-8-25(39-2)34-15-18)13-20(22)26(24)37(27(35)38)19-5-7-23(21(14-19)28(29,30)31)36-11-9-32-10-12-36/h3-8,13-16,32H,9-12H2,1-2H3 |
| CAS Number | 915020-55-2 |
| Related CAS |
| Packaging | Price | Availability | Purity | Shipping Time |
|---|---|---|---|---|
| Bulk | Enquiry | Enquiry | Enquiry |
| Formulation | Solid powder |
|---|---|
| Purity | 98% |
| Storage | -20 ºC for 3 years |
| Solubility | Soluble in DMSO |
| Handling | |
| Shipping Condition | Shipped under ambient temperature |
| HS Code |
| Targets | |
|---|---|
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study |