AZD6482 is a potent, selective and ATP competitive PI3K inhibitor (IC(50) 0.01 μm). AZD6482 inhibited insulin-induced human adipocyte glucose uptake in vitro (IC(50) of 4.4 μm). This is the first human target validation for PI3K inhibition as anti-platelet therapy showing a mild and generalized antiplatelet effect attenuating but not completely inhibiting multiple signaling pathways with an impressive separation towards primary hemostasis. AZD6482 at 'supratherapeutic' plasma concentrations may attenuate insulin signaling, most likely through PI3K inhibition.
For research use only. We do not sell to patients.
| Name | AZD6482 (S-isomer) |
|---|---|
| Iupac Chemical Name | (S)-2-((1-(7-methyl-2-morpholino-4-oxo-4H-pyrido[1,2-a]pyrimidin-9-yl)ethyl)amino)benzoic acid |
| Synonyms | AZD6482 (S); AZD6482; AZD-6482; AZD 6482 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.458 |
| Smile | CC=1C=C(C=2N(C(C=C(N2)N2CCOCC2)=O)C1)[C@H](C)NC1=C(C(=O)O)C=CC=C1 |
| InChiKey | IRTDIKMSKMREGO-HNNXBMFYSA-N |
| InChi | InChI=1S/C22H24N4O4/c1-14-11-17(15(2)23-18-6-4-3-5-16(18)22(28)29)21-24-19(12-20(27)26(21)13-14)25-7-9-30-10-8-25/h3-6,11-13,15,23H,7-10H2,1-2H3,(H,28,29)/t15-/m0/s1 |
| CAS Number | 1173900-37-2 |
| Related CAS |
| Packaging | Price | Availability | Purity | Shipping Time |
|---|---|---|---|---|
| Bulk | Enquiry | Enquiry | Enquiry |
| Formulation | crystalline solid |
|---|---|
| Purity | 98% |
| Storage | 3 years -20ºCpowder |
| Solubility | Soluble in DMSO |
| Handling | |
| Shipping Condition | Shipped under ambient temperature as non-hazardous chemical. |
| HS Code |
| Targets | |
|---|---|
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study |