AOH1160 is a potent oral small molecule proliferating cell nuclear antigen (PCNA) inhibitor
For research use only. We do not sell to patients.
| Name | AOH1160 |
|---|---|
| Iupac Chemical Name | N-(2-oxo-2-((2-phenoxyphenyl)amino)ethyl)-1-naphthamide |
| Synonyms | AOH1160; AOH 1160; AOH-1160 |
| Molecular Formula | C25H20N2O3 |
| Molecular Weight | 396.44 |
| Smile | O=C(C1=C2C=CC=CC2=CC=C1)NCC(NC3=CC=CC=C3OC4=CC=CC=C4)=O |
| InChiKey | COPRLRLXDBSLET-UHFFFAOYSA-N |
| InChi | InChI=1S/C25H20N2O3/c28-24(17-26-25(29)21-14-8-10-18-9-4-5-13-20(18)21)27-22-15-6-7-16-23(22)30-19-11-2-1-3-12-19/h1-16H,17H2,(H,26,29)(H,27,28) |
| CAS Number | 2089314-57-6 |
| Related CAS |
| Packaging | Price | Availability | Purity | Shipping Time |
|---|---|---|---|---|
| Bulk | Enquiry | Enquiry | Enquiry |
| Formulation | Off-white solid |
|---|---|
| Purity | 98% Min. |
| Storage | Dry, dark and at 0 - 4℃ for short term (days to weeks) or -20℃ for long term (months to years). |
| Solubility | Soluble in DMSO |
| Handling | |
| Shipping Condition | Shipped under ambient temperature as non-hazardous chemical. This product is stable enough for a few weeks during ordinary shipping and time spent in Customs. |
| HS Code |
| Targets | |
|---|---|
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study |