5-hydroxypyrazine-2-carboxylic acid , a metabolite of anti-tuberculosis drug pyrazinamide (PZA).
For research use only. We do not sell to patients.
| Name | 5-hydroxypyrazine-2-carboxylic acid |
|---|---|
| Iupac Chemical Name | 5-hydroxypyrazine-2-carboxylic acid |
| Synonyms | N/A |
| Molecular Formula | C₅H₄N₂O₃ |
| Molecular Weight | 140.1 |
| Smile | OC=1N=CC(=NC1)C(=O)O |
| InChiKey | CGQFCIHUUCMACC-UHFFFAOYSA-N |
| InChi | InChI=1S/C5H4N2O3/c8-4-2-6-3(1-7-4)5(9)10/h1-2H,(H,7,8)(H,9,10) |
| CAS Number | 34604-60-9 |
| Related CAS |
| Packaging | Price | Availability | Purity | Shipping Time |
|---|---|---|---|---|
| Bulk | Enquiry | Enquiry | Enquiry |
| Formulation | crystalline solid |
|---|---|
| Purity | 98% |
| Storage | 3 years -20ºCpowder |
| Solubility | Soluble in DMSO |
| Handling | |
| Shipping Condition | Shipped under ambient temperature as non-hazardous chemical. |
| HS Code |
| Targets | |
|---|---|
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study |