For research use only. We do not sell to patients.
| Name | 5,6-Dichloropyridazin-4-amine |
|---|---|
| Molecular Formula | C4H3Cl2N3 |
| Molecular Weight | 163.993 |
| Smile | ClC=1C(=CN=NC1Cl)N |
| InChiKey | IECXBOCRHHKNKS-UHFFFAOYSA-N |
| InChi | InChI=1S/C4H3Cl2N3/c5-3-2(7)1-8-9-4(3)6/h1H,(H2,7,9) |
| CAS Number | 89180-50-7 |
| Related CAS |
| Packaging | Price | Availability | Purity | Shipping Time |
|---|---|---|---|---|
| Bulk | Enquiry | Enquiry | Enquiry |
| Formulation | Solid powder |
|---|---|
| Purity | 97% |
| Storage | -20 ºC for 3 years |
| Solubility | Soluble in DMSO |
| Handling | |
| Shipping Condition | Shipped under ambient temperature |
| HS Code |
| Targets | |
|---|---|
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study |