For research use only. We do not sell to patients.
| Name | 4-Fluoro-1-indanone |
|---|---|
| Synonyms | 4-fluoro-2,3-dihydroinden-1-one |
| Molecular Formula | C9H7FO |
| Molecular Weight | 150.15 |
| Smile | FC1=C2CCC(C2=CC=C1)=O |
| InChiKey | HOMSJDBZHCPYHY-UHFFFAOYSA-N |
| InChi | InChI=1S/C9H7FO/c10-8-3-1-2-7-6(8)4-5-9(7)11/h1-3H,4-5H2 |
| CAS Number | 699-99-0 |
| Related CAS |
| Packaging | Price | Availability | Purity | Shipping Time |
|---|---|---|---|---|
| Bulk | Enquiry | Enquiry | Enquiry |
| Formulation | Solid powder |
|---|---|
| Purity | 98% |
| Storage | -20 ºC for 3 years |
| Solubility | Soluble in DMSO |
| Handling | |
| Shipping Condition | Shipped under ambient temperature |
| HS Code |
| Targets | |
|---|---|
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study |