For research use only. We do not sell to patients.
| Name | 3-Cyanobenzenepropanoic acid |
|---|---|
| Synonyms | 3-(3-cyanophenyl)propanoic acid |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.184 |
| Smile | C(#N)C=1C=C(C=CC1)CCC(=O)O |
| InChiKey | GZVGDSHPRRFWFQ-UHFFFAOYSA-N |
| InChi | InChI=1S/C10H9NO2/c11-7-9-3-1-2-8(6-9)4-5-10(12)13/h1-3,6H,4-5H2,(H,12,13) |
| CAS Number | 42287-97-8 |
| Related CAS |
| Packaging | Price | Availability | Purity | Shipping Time |
|---|---|---|---|---|
| Bulk | Enquiry | Enquiry | Enquiry |
| Formulation | Solid powder |
|---|---|
| Purity | 98% |
| Storage | -20 ºC for 3 years |
| Solubility | Soluble in DMSO |
| Handling | |
| Shipping Condition | Shipped under ambient temperature |
| HS Code |
| Targets | |
|---|---|
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study |