For research use only. We do not sell to patients.
| Name | 2,6-DIFLUORO-4-[2-(PHENYLSULFONYLAMINO)E |
|---|---|
| Iupac Chemical Name | 2,6-DIFLUORO-4-[2-(PHENYLSULFONYLAMINO)E |
| Molecular Formula | C16H16F2N2O4S2 |
| Molecular Weight | 402.44 |
| Smile | O=C(N)COC1=C(F)C=C(SCCNS(=O)(C2=CC=CC=C2)=O)C=C1F |
| InChiKey | GTACSIONMHMRPD-UHFFFAOYSA-N |
| InChi | InChI=1S/C16H16F2N2O4S2/c17-13-8-11(9-14(18)16(13)24-10-15(19)21)25-7-6-20-26(22,23)12-4-2-1-3-5-12/h1-5,8-9,20H,6-7,10H2,(H2,19,21) |
| CAS Number | 141286-78-4 |
| Related CAS |
| Packaging | Price | Availability | Purity | Shipping Time |
|---|---|---|---|---|
| Bulk | Enquiry | Enquiry | Enquiry |
| Formulation | Solid powder |
|---|---|
| Purity | 98% Min. |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| Solubility | Soluble in DMSO |
| Handling | |
| HS Code |
| Targets | |
|---|---|
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study |