For research use only. We do not sell to patients.
| Name | (R)-(+)-2-Piperazinecarboxylic Acid Dihydrochloride |
|---|---|
| Synonyms | (R)-(+)-2-Piperazinecarboxylic Acid Dihydrochloride |
| Molecular Formula | C5H12Cl2N2O2 |
| Molecular Weight | 203.067 |
| Smile | C1CN[C@H](CN1)C(=O)O.Cl.Cl |
| InChiKey | WNSDZBQLMGKPQS-RZFWHQLPSA-N |
| InChi | InChI=1S/C5H10N2O2.2ClH/c8-5(9)4-3-6-1-2-7-4;;/h4,6-7H,1-3H2,(H,8,9);2*1H/t4-;;/m1../s1 |
| CAS Number | 126330-90-3 |
| MDL | MFCD03840829 |
| Related CAS |
| Packaging | Price | Availability | Purity | Shipping Time |
|---|---|---|---|---|
| Bulk | Enquiry | Enquiry | Enquiry |
| Formulation | Solid powder |
|---|---|
| Purity | 98% |
| Storage | -20 ºC for 3 years |
| Solubility | Soluble in DMSO |
| Handling | |
| Shipping Condition | Shipped under ambient temperature |
| HS Code |
| Targets | |
|---|---|
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study |