For research use only. We do not sell to patients.
| Name | (1S)-1-(2,5-dimethylphenyl)ethanamine |
|---|---|
| Synonyms | Benzylamine,a,2,5-trimethyl-,(-); (S)-1-(2,5-Dimethyl-phenyl)-aethylamin; (S)-1-(2,5-dimethyl-phenyl)-ethylamine |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.233 |
| Smile | CC1=C(C=C(C=C1)C)[C@H](C)N |
| InChiKey | ULGHUDXDTMIEAM-VIFPVBQESA-N |
| InChi | InChI=1S/C10H15N/c1-7-4-5-8(2)10(6-7)9(3)11/h4-6,9H,11H2,1-3H3/t9-/m0/s1 |
| CAS Number | 4187-33-1 |
| Related CAS |
| Packaging | Price | Availability | Purity | Shipping Time |
|---|---|---|---|---|
| Bulk | Enquiry | Enquiry | Enquiry |
| Formulation | Solid powder |
|---|---|
| Purity | 98% |
| Storage | -20 ºC for 3 years |
| Solubility | Soluble in DMSO |
| Handling | |
| Shipping Condition | Shipped under ambient temperature |
| HS Code |
| Targets | |
|---|---|
| Mechanism | |
| Cell study | |
| Animal study | |
| Clinical study |